CAS 103614-06-8
:dynorphin A amide (1-9), Cys(2)-Cys(5)-MeArg(7)-Leu(8)-
Description:
Dynorphin A amide (1-9) is a peptide that belongs to the dynorphin family, which are endogenous opioid peptides derived from proenkephalin. This specific variant consists of nine amino acids and features a unique sequence that includes cysteine residues and a methylated arginine, contributing to its structural and functional properties. The presence of cysteine residues allows for the formation of disulfide bonds, which are crucial for maintaining the peptide's three-dimensional conformation and biological activity. Dynorphin A amide (1-9) is known to interact with opioid receptors, particularly the kappa-opioid receptor, influencing pain modulation, stress response, and various neurophysiological processes. Its amide form enhances stability and bioavailability compared to its free acid counterpart. The CAS number 103614-06-8 uniquely identifies this compound in chemical databases, facilitating research and application in pharmacology and neuroscience. Overall, dynorphin A amide (1-9) plays a significant role in the complex signaling pathways of the nervous system, making it a subject of interest in studies related to pain and addiction.
Formula:C51H81N19O10S2
InChI:InChI=1/C51H81N19O10S2/c1-28(2)22-36(67-43(75)33(59-3)12-7-19-60-49(53)54)46(78)65-34(13-8-20-61-50(55)56)44(76)70-45(77)35(14-9-21-62-51(57)58)66-48(80)39(27-82)69-47(79)37(24-29-10-5-4-6-11-29)64-40(72)25-63-42(74)38(26-81)68-41(73)32(52)23-30-15-17-31(71)18-16-30/h4-6,10-11,15-18,26,28,32-39,59,71,82H,7-9,12-14,19-25,27,52H2,1-3H3,(H,63,74)(H,64,72)(H,65,78)(H,66,80)(H,67,75)(H,68,73)(H,69,79)(H4,53,54,60)(H4,55,56,61)(H4,57,58,62)(H,70,76,77)/t32-,33-,34-,35-,36+,37-,38+,39-/m0/s1
Synonyms:- Daaccal
- 2-Cys-5-cys-7-mearg-8-leu-dynorphin A (1-9)-NH2
- Dynorphin A amide (1-9), cys(2)-cys(5)-mearg(7)-leu(8)-
- (2R)-N-[(1S)-1-[[(2S)-2-[[(2R)-2-[[(2S)-2-[[2-[[(2S)-2-[[(2S)-2-amino-3-(4-hydroxyphenyl)propanoyl]amino]-3-thioxo-propanoyl]amino]acetyl]amino]-3-phenyl-propanoyl]amino]-3-sulfanyl-propanoyl]amino]-5-guanidino-pentanoyl]carbamoyl]-4-guanidino-butyl]-2-[[(2S)-5-guanidino-2-methylamino-pentanoyl]amino]-4-methyl-pentanamide
- Dynorphin A amide (1-9), cysteinyl(2)-cysteinyl(5)-methylarginyl(7)-leucine(8)-
- L-Argininamide, L-tyrosyl-D-cysteinylglycyl-L-phenylalanyl-L-cysteinyl-L-arginyl-N2-methyl-L-arginyl-D-leucyl-, cyclic (2-5)-disulfide
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
Daaccal
CAS:Daaccal can be used for relevant research in the life sciences. Its product number is T31173 and CAS number is 103614-06-8.Formula:C51H81N19O10S2Color and Shape:SolidMolecular weight:1184.45
