CAS 103614-82-0
:2-chloro-4-nitrophenyl-N-acetyl-beta-D-glucosaminide
Description:
2-Chloro-4-nitrophenyl-N-acetyl-beta-D-glucosaminide is a chemical compound that belongs to the class of glycosides, specifically a derivative of glucosamine. It features a glucosamine backbone modified with an N-acetyl group and a 2-chloro-4-nitrophenyl moiety, which contributes to its reactivity and potential applications in biochemical research. The presence of the nitro group indicates that it may participate in electrophilic aromatic substitution reactions, while the chloro group can enhance its electrophilicity. This compound is often utilized in studies related to enzyme activity, particularly in glycosidase assays, due to its structural similarity to natural substrates. Its solubility characteristics may vary depending on the solvent used, and it is generally stable under standard laboratory conditions. However, as with many nitro compounds, it may require careful handling due to potential toxicity and environmental concerns. Overall, 2-chloro-4-nitrophenyl-N-acetyl-beta-D-glucosaminide serves as a valuable tool in chemical biology and medicinal chemistry research.
Formula:C14H17ClN2O8
InChI:InChI=1/C14H17ClN2O8/c1-6(19)16-11-13(21)12(20)10(5-18)25-14(11)24-9-3-2-7(17(22)23)4-8(9)15/h2-4,10-14,18,20-21H,5H2,1H3,(H,16,19)/t10-,11-,12-,13-,14-/m1/s1
SMILES:CC(=N[C@@H]1[C@H]([C@@H]([C@@H](CO)O[C@H]1Oc1ccc(cc1Cl)N(=O)=O)O)O)O
Synonyms:- Cnp-Nag
- 2-Chloro-4-nitro-acetyl-β-D-glucosaminide
- 2-chloro-4-nitrophenyl 2-(acetylamino)-2-deoxy-beta-D-glucopyranoside
- 2-chloro-4-nitrophenyl-N-acetyl-β-D-glucosaminide
- 2-Chloro-4-Nitrophenyl-N-Acetylglucosaminide
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
2-Chloro-4-nitrophenyl 2-Acetamido-2-deoxy-b-d-glucopyranoside
CAS:Controlled ProductApplications 2-Chloro-4-nitrophenyl 2-acetamido-2-deoxy-b-D-glucopyranoside (cas# 103614-82-0) is a useful research chemical.
Formula:C14H17N2O8ClColor and Shape:NeatMolecular weight:376.752-Chloro-4-nitrophenyl 2-acetamido-2-deoxy-β-D-glucopyranoside
CAS:2-Chloro-4-nitrophenyl 2-acetamido-2-deoxy-β-D-glucopyranoside is a chromogenic substrate used for beta-N-acetylglucosaminidase assays. Upon enzymatic hydrolysis, 2-chloro-4-nitrophenol is released, which has a yellowish color. It is used in diagnostic applications such as lysosomal storage disorder diagnosis (for example, Tay-Sachs disease) and glycosidase inhibition studies.Formula:C14H17ClN2O8Purity:Min. 98 Area-%Color and Shape:White PowderMolecular weight:376.75 g/mol



