CAS 1036243-79-4

3,4-Bis[[(1,1-dimethylethyl)dimethylsilyl]oxy]benzenemethanol

Description:

3,4-Bis[[(1,1-dimethylethyl)dimethylsilyl]oxy]benzenemethanol is a chemical compound characterized by its complex structure, which includes a benzene ring substituted with two silyl ether groups and a hydroxymethyl group. The presence of the dimethylethyl groups contributes to its hydrophobic properties, while the silyl groups enhance its thermal stability and resistance to moisture. This compound is typically used in specialized applications, including as a potential intermediate in organic synthesis or as a protective agent in various chemical processes. Its unique structure may also impart specific reactivity patterns, making it of interest in materials science and polymer chemistry. The compound's solubility, stability, and reactivity can be influenced by the steric hindrance introduced by the bulky silyl groups. Overall, 3,4-Bis[[(1,1-dimethylethyl)dimethylsilyl]oxy]benzenemethanol exemplifies the interplay between organic and organosilicon chemistry, showcasing how modifications to molecular structure can lead to diverse functional properties.

Formula: C₁₉H₃₆O₃Si₂

InChI: InChI=1S/C19H36O3Si2/c1-18(2,3)23(7,8)21-16-12-11-15(14-20)13-17(16)22-24(9,10)19(4,5)6/h11-13,20H,14H2,1-10H3

InChI key: InChIKey=VQXBMHBNSMMAOR-UHFFFAOYSA-N

SMILES: O([Si](C(C)(C)C)(C)C)C1=C(O[Si](C(C)(C)C)(C)C)C=C(CO)C=C1

Synonyms:

• Benzenemethanol, 3,4-bis[[(1,1-dimethylethyl)dimethylsilyl]oxy]-
• 3,4-Bis[[(1,1-dimethylethyl)dimethylsilyl]oxy]benzenemethanol
• (3,4-Bis((tert-butyldimethylsilyl)oxy)phenyl)methanol
• 3,4-Bis[(tert-butyldimethylsilyl)oxy]benzyl Alcohol

3,4-Bis[(tert-butyldimethylsilyl)oxy]benzylAlcohol

CAS: 1036243-79-4

Formula: C₁₉H₃₆O₃Si₂

Purity: 95%

Molecular weight: 368.6583

Ref: IN-DA01DF2R