![{5-[(methylsulfamoyl)methyl]-1H-indol-3-yl}acetic acid](/_next/image/?url=https%3A%2Fstatic.cymitquimica.com%2Fcas-image%2Fthumb-webp%2F340085-5-methylsulfamoyl-methyl-1h-indol-3-yl-acetic-acid.webp&w=3840&q=75)
CAS 103628-44-0
:{5-[(methylsulfamoyl)methyl]-1H-indol-3-yl}acetic acid
Description:
{5-[(methylsulfamoyl)methyl]-1H-indol-3-yl}acetic acid, with the CAS number 103628-44-0, is a chemical compound that features an indole structure, which is a bicyclic compound consisting of a benzene ring fused to a pyrrole ring. This substance contains a methylsulfamoyl group, contributing to its potential biological activity, particularly in medicinal chemistry. The presence of the acetic acid moiety suggests that it may exhibit acidic properties, influencing its solubility and reactivity in various environments. The compound is likely to engage in hydrogen bonding due to the functional groups present, which can affect its interactions with biological targets. Additionally, the indole framework is known for its role in various pharmacological activities, making this compound of interest in drug development. Its specific characteristics, such as melting point, solubility, and stability, would depend on the molecular interactions and the environment in which it is studied. Overall, this compound represents a unique structure with potential applications in pharmaceuticals.
Formula:C12H14N2O4S
InChI:InChI=1/C12H14N2O4S/c1-13-19(17,18)7-8-2-3-11-10(4-8)9(6-14-11)5-12(15)16/h2-4,6,13-14H,5,7H2,1H3,(H,15,16)
SMILES:CNS(=O)(=O)Cc1ccc2c(c1)c(CC(=O)O)c[nH]2
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 3 products.
