CAS 1036381-92-6

1,1-Dimethylethyl 3-bromo-1,5,7,8-tetrahydro-2-oxo-1,6-naphthyridine-6(2H)-carboxylate

Description:

1,1-Dimethylethyl 3-bromo-1,5,7,8-tetrahydro-2-oxo-1,6-naphthyridine-6(2H)-carboxylate, with CAS number 1036381-92-6, is a chemical compound characterized by its complex structure, which includes a naphthyridine core and various functional groups. This compound features a bromine atom, which contributes to its reactivity and potential applications in organic synthesis. The presence of the dimethyl group indicates steric hindrance, which can influence its chemical behavior and interactions. The carboxylate group suggests potential for forming salts or participating in esterification reactions. Additionally, the tetrahydro configuration implies that the compound is a saturated derivative, which may affect its solubility and stability. Overall, this compound may exhibit interesting biological or pharmacological properties, making it a candidate for further research in medicinal chemistry or related fields. Its specific characteristics, such as melting point, boiling point, and solubility, would require empirical data for precise determination.

Formula: C₁₃H₁₇BrN₂O₃

InChI: InChI=1S/C13H17BrN2O3/c1-13(2,3)19-12(18)16-5-4-10-8(7-16)6-9(14)11(17)15-10/h6H,4-5,7H2,1-3H3,(H,15,17)

InChI key: InChIKey=ZAZWMOVLWWDQHH-UHFFFAOYSA-N

SMILES: C(OC(C)(C)C)(=O)N1CC2=C(CC1)NC(=O)C(Br)=C2

Synonyms:

• 1,1-Dimethylethyl 3-bromo-1,5,7,8-tetrahydro-2-oxo-1,6-naphthyridine-6(2H)-carboxylate
• tert-Butyl 3-Bromo-2-oxo-1,5,7,8-tetrahydro-1,6-naphthyridine-6-carboxylate
• 1,6-Naphthyridine-6(2H)-carboxylic acid, 3-bromo-1,5,7,8-tetrahydro-2-oxo-, 1,1-dimethylethyl ester