CAS 10364-69-9
:5-Ethyl-3-(3-nitrophenyl)-1,2,4-oxadiazole
Description:
5-Ethyl-3-(3-nitrophenyl)-1,2,4-oxadiazole is a heterocyclic organic compound characterized by the presence of an oxadiazole ring, which consists of two nitrogen atoms and three carbon atoms in a five-membered ring. The compound features an ethyl group at the 5-position and a nitrophenyl group at the 3-position, contributing to its unique chemical properties. It is typically a solid at room temperature and may exhibit yellow to orange coloration due to the nitro group, which can influence its electronic properties. This compound is of interest in various fields, including materials science and medicinal chemistry, due to its potential applications in organic electronics, as well as its biological activity. The presence of the nitro group can enhance the compound's reactivity and may impart specific pharmacological properties. As with many organic compounds, its solubility, stability, and reactivity can vary based on environmental conditions such as pH and temperature. Safety data should be consulted for handling and usage, as nitro compounds can be sensitive and potentially hazardous.
Formula:C10H9N3O3
InChI:InChI=1S/C10H9N3O3/c1-2-9-11-10(12-16-9)7-4-3-5-8(6-7)13(14)15/h3-6H,2H2,1H3
InChI key:InChIKey=MPQWRVZHBRBTEK-UHFFFAOYSA-N
SMILES:C(C)C1=NC(=NO1)C2=CC(N(=O)=O)=CC=C2
Synonyms:- 1,2,4-Oxadiazole, 5-ethyl-3-(m-nitrophenyl)-
- 5-Ethyl-3-(3-nitrophenyl)-1,2,4-oxadiazole
- 1,2,4-Oxadiazole, 5-ethyl-3-(3-nitrophenyl)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
