CAS 10364-94-0
:1H-Imidazol-1-ylphenylmethanone
Description:
1H-Imidazol-1-ylphenylmethanone, with the CAS number 10364-94-0, is an organic compound characterized by its imidazole and phenyl functional groups. This substance typically appears as a crystalline solid and is known for its role in various chemical reactions, particularly in the synthesis of pharmaceuticals and agrochemicals. The imidazole ring contributes to its potential biological activity, making it of interest in medicinal chemistry. It exhibits moderate solubility in polar organic solvents, which can influence its reactivity and interaction with other compounds. The presence of the carbonyl group (ketone) in the structure enhances its electrophilic character, allowing it to participate in nucleophilic addition reactions. Additionally, the compound may exhibit specific optical properties, making it useful in applications such as fluorescence or as a ligand in coordination chemistry. Overall, 1H-Imidazol-1-ylphenylmethanone is a versatile compound with significant implications in synthetic organic chemistry and drug development.
Formula:C10H8N2O
InChI:InChI=1S/C10H8N2O/c13-10(12-7-6-11-8-12)9-4-2-1-3-5-9/h1-8H
InChI key:InChIKey=JEGIFBGJZPYMJS-UHFFFAOYSA-N
SMILES:C(=O)(N1C=CN=C1)C2=CC=CC=C2
Synonyms:- 1-Benzoyl-1H-imidazole
- 1-Benzoylimidazole
- 1H-Imidazol-1-ylphenylmethanone
- 1H-Imidazole, 1-benzoyl-
- 1H-imidazol-1-yl(phenyl)methanone
- Imidazole, 1-benzoyl-
- Methanone, 1H-imidazol-1-ylphenyl-
- N-Benzoylimidazole
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 6 products.
(1H-Imidazol-1-Yl)(Phenyl)Methanone
CAS:(1H-Imidazol-1-Yl)(Phenyl)MethanonePurity:99%Molecular weight:172.18g/mol(1H-Imidazol-1-yl)(phenyl)methanone
CAS:Formula:C10H8N2OPurity:>95.0%(GC)(T)Color and Shape:White or Colorless to Yellow to Orange powder to lump to clear liquidMolecular weight:172.19N-Benzoylimidazole
CAS:N-Benzoylimidazole is a compound that belongs to the class of heterocycles. It is used as a precursor in the synthesis of other organic compounds. N-Benzoylimidazole reacts with trifluoroacetic acid and ethyl formate to produce uridine, oxetane, and detergent compositions. The reaction products are hydroxyl group, kinetic, copper complex, cancer, 3-benzoylpyridine and chloride. Dibutyltin oxide is used as a catalyst for this chemical reaction mechanism. Reaction with benzoate produces an intermediate that can be converted into other heterocyclic compounds.Formula:C10H8N2OPurity:Min. 95%Color and Shape:Yellow Clear LiquidMolecular weight:172.18 g/mol
