CAS 10364-95-1

(4-Chlorophenyl)-1H-imidazol-1-ylmethanone

Description:

(4-Chlorophenyl)-1H-imidazol-1-ylmethanone, with the CAS number 10364-95-1, is a chemical compound characterized by its imidazole ring and a chlorophenyl group. This compound typically exhibits properties associated with both aromatic and heterocyclic compounds, including potential biological activity due to the presence of the imidazole moiety, which is known for its role in various pharmacological applications. The chlorophenyl group can influence the compound's lipophilicity and reactivity, potentially enhancing its interaction with biological targets. In terms of solubility, compounds of this nature may exhibit moderate solubility in organic solvents, while their solubility in water can vary based on the specific substituents and their electronic effects. The compound may also display interesting thermal and stability characteristics, making it suitable for various synthetic applications. Overall, (4-Chlorophenyl)-1H-imidazol-1-ylmethanone is of interest in medicinal chemistry and could serve as a scaffold for the development of new therapeutic agents.

Formula: C₁₀H₇ClN₂O

InChI: InChI=1S/C10H7ClN2O/c11-9-3-1-8(2-4-9)10(14)13-6-5-12-7-13/h1-7H

InChI key: InChIKey=BIXVWOXDISCYRE-UHFFFAOYSA-N

SMILES: C(=O)(C1=CC=C(Cl)C=C1)N2C=CN=C2

Synonyms:

• 1-(p-Chlorobenzoyl)imidazole
• (4-Chlorophenyl)-1H-imidazol-1-ylmethanone
• Imidazole, 1-(p-chlorobenzoyl)-
• Methanone, (4-chlorophenyl)-1H-imidazol-1-yl-
• 1H-Imidazole, 1-(4-chlorobenzoyl)-