CAS 1036572-10-7
:α-(1-Methylethyl)-3-(4-pyridinyl)-1,2,4-oxadiazole-5-methanamine
Description:
α-(1-Methylethyl)-3-(4-pyridinyl)-1,2,4-oxadiazole-5-methanamine is a chemical compound characterized by its unique structure, which includes an oxadiazole ring fused with a pyridine moiety. This compound typically exhibits properties associated with heterocyclic compounds, such as potential biological activity, making it of interest in medicinal chemistry. The presence of the methanamine group suggests it may participate in hydrogen bonding, influencing its solubility and reactivity. Additionally, the 4-pyridinyl substituent can contribute to the compound's electronic properties, potentially enhancing its interaction with biological targets. The compound's molecular structure may allow for various functionalizations, which can be explored for developing derivatives with improved efficacy or selectivity in pharmacological applications. Overall, this compound's characteristics make it a candidate for further research in drug development and related fields.
Formula:C11H14N4O
InChI:InChI=1S/C11H14N4O/c1-7(2)9(12)11-14-10(15-16-11)8-3-5-13-6-4-8/h3-7,9H,12H2,1-2H3
InChI key:InChIKey=SSBOSRNJRZXAPR-UHFFFAOYSA-N
SMILES:C(C(C)C)(N)C1=NC(=NO1)C=2C=CN=CC2
Synonyms:- 1,2,4-Oxadiazole-5-methanamine, α-(1-methylethyl)-3-(4-pyridinyl)-
- α-(1-Methylethyl)-3-(4-pyridinyl)-1,2,4-oxadiazole-5-methanamine
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.