CymitQuimica logo

CAS 103659-08-1

:

2-methyl-N-nitrosothiazolidine-4-carboxylic acid

Description:
2-Methyl-N-nitrosothiazolidine-4-carboxylic acid is a chemical compound characterized by its thiazolidine ring structure, which incorporates a nitroso group and a carboxylic acid functional group. This compound is notable for its potential biological activity, particularly in the context of nitrosamine formation, which can have implications in toxicology and carcinogenicity. The presence of the methyl group at the second position of the thiazolidine ring influences its reactivity and stability. As a nitrosamine derivative, it may exhibit properties that are relevant in pharmacology and environmental chemistry. The compound's solubility, melting point, and specific reactivity can vary based on its molecular interactions and the presence of other functional groups. Safety data sheets and toxicological studies are essential for understanding its handling and potential health effects, as nitrosamines are often associated with various health risks. Overall, 2-methyl-N-nitrosothiazolidine-4-carboxylic acid represents a compound of interest in both synthetic chemistry and biological research.
Formula:C5H8N2O3S
InChI:InChI=1/C5H8N2O3S/c1-3-7(6-10)4(2-11-3)5(8)9/h3-4H,2H2,1H3,(H,8,9)
SMILES:CC1N(C(CS1)C(=O)O)N=O
Synonyms:
  • Mnca
  • 4-Thiazolidinecarboxylic acid, 2-methyl-3-nitroso-
  • 2-Methyl-3-Nitroso-1,3-Thiazolidine-4-Carboxylic Acid
  • 2-Methyl-N-nitrosothiazolidine-4-carboxylic acid
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 4 products.