CAS 10366-71-9

(2-aminoethoxy)acetic acid

Description:

(2-aminoethoxy)acetic acid, also known as aminoethyl glycine, is an organic compound characterized by the presence of both amino and carboxylic acid functional groups, which contribute to its properties as an amino acid derivative. It features an ethoxy group, which enhances its solubility in polar solvents. The compound is typically a white crystalline solid at room temperature and is soluble in water due to its polar nature. Its molecular structure allows it to participate in various chemical reactions, making it useful in biochemical applications, particularly in the synthesis of peptides and as a potential building block in pharmaceuticals. The presence of the amino group enables it to act as a weak base, while the carboxylic acid group can donate protons, allowing it to function as a zwitterion under certain conditions. Additionally, (2-aminoethoxy)acetic acid may exhibit biological activity, influencing metabolic pathways or acting as a neurotransmitter precursor. Safety data should be consulted for handling and storage, as with all chemical substances.

Formula: C₄H₉NO₃

InChI: InChI=1/C4H9NO3/c5-1-2-8-3-4(6)7/h1-3,5H2,(H,6,7)

SMILES: C(COCC(=O)O)N

Synonyms:

• 2-(2-Aminoethoxy)Acetic Acid
• Acetic acid, 2-(2-aminoethoxy)-
• (2-Aminoethoxy)acetic acid

(2-Aminoethoxy)acetic acid, 98%

CAS: 10366-71-9

Reactant in the synthesis ammonium ion-selective fluoroionophore. Used in the analysis of recognition elements for mitochondrial processing peptidase. This Thermo Scientific Chemicals brand product was originally part of the Alfa Aesar product portfolio. Some documentation and label information may

Formula: C₄H₉NO₃

Purity: 98%

Color and Shape: White to pale cream, Powder

Molecular weight: 119.12

Ref: 02-H52289

Acetic acid, (2-aminoethoxy)-

CAS: 10366-71-9

Formula: C₄H₉NO₃

Purity: 97%

Color and Shape: Solid

Molecular weight: 119.1192

Ref: IN-DA007FWG

2-(2-Aminoethoxy)acetic acid

CAS: 10366-71-9

2-(2-Aminoethoxy)acetic acid

Purity: 97%

Molecular weight: 119.12g/mol

Ref: 54-OR84729

(2-Amino-ethoxy)-acetic acid

CAS: 10366-71-9

Formula: C₄H₉NO₃

Purity: 97%

Color and Shape: Solid

Molecular weight: 119.12

Ref: 10-F046334