CAS 10366-75-3
:mannono-1,5-lactone
Description:
Mannono-1,5-lactone is a cyclic ester derived from mannose, a six-carbon aldose sugar. It is characterized by its five-membered lactone ring, which is formed through the intramolecular reaction of the hydroxyl group on the first carbon with the carboxylic acid group on the fifth carbon. This compound is typically a white to off-white solid and is soluble in water due to its polar nature. Mannono-1,5-lactone exhibits properties typical of lactones, including the ability to undergo hydrolysis to regenerate the corresponding hydroxy acid. It is of interest in various biochemical and pharmaceutical applications, particularly in the study of carbohydrate metabolism and as a potential precursor in the synthesis of other bioactive compounds. The compound's stability and reactivity can be influenced by environmental factors such as pH and temperature, making it a subject of interest in both synthetic and natural product chemistry. Overall, mannono-1,5-lactone serves as a valuable model for understanding lactone chemistry and its implications in biological systems.
Formula:C6H10O6
InChI:InChI=1/C6H10O6/c7-1-2-3(8)4(9)5(10)6(11)12-2/h2-5,7-10H,1H2/t2-,3-,4+,5+/m1/s1
Synonyms:- D-Mannonolactone
- Mannono-delta-lactone
- Mannonic acid, delta-lactone
- (3S,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)tetrahydro-2H-pyran-2-one (non-preferred name)
- Mannono-1,5-lactone
- delta-DL-Mannonolactone
- Mannonic acid, δ-lactone
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 2 products.
