CAS 103661-14-9
:1,3-Dioxolane-4-methanol, 2-(2,4-dichlorophenyl)-2-(4H-1,2,4-triazol-4-ylmethyl)-, methanesulfonate (ester), (2R,4R)-rel-
Description:
1,3-Dioxolane-4-methanol, 2-(2,4-dichlorophenyl)-2-(4H-1,2,4-triazol-4-ylmethyl)-, methanesulfonate (ester), (2R,4R)-rel- is a complex organic compound characterized by its dioxolane ring structure, which contributes to its stability and reactivity. The presence of a methanesulfonate ester group enhances its solubility in polar solvents and may influence its biological activity. The dichlorophenyl moiety introduces significant lipophilicity, potentially affecting its interaction with biological membranes. Additionally, the triazole ring is known for its role in various pharmacological applications, often exhibiting antifungal and antibacterial properties. The specific stereochemistry indicated by (2R,4R)-rel- suggests that the compound has defined spatial arrangements, which can be crucial for its biological efficacy and interaction with target molecules. Overall, this compound's unique structural features suggest potential applications in medicinal chemistry, particularly in the development of therapeutic agents. However, detailed studies would be necessary to fully elucidate its properties and potential uses.
Formula:C14H15Cl2N3O5S
InChI:InChI=1/C14H15Cl2N3O5S/c1-25(20,21)23-6-11-5-22-14(24-11,7-19-8-17-18-9-19)12-3-2-10(15)4-13(12)16/h2-4,8-9,11H,5-7H2,1H3/t11-,14+/s2
InChI key:InChIKey=PIVYXNNEDVRQJV-JOYKWEQTNA-N
SMILES:C([C@]1(O[C@@H](COS(C)(=O)=O)CO1)C2=C(Cl)C=C(Cl)C=C2)N3C=NN=C3
Synonyms:- 1,3-Dioxolane-4-methanol, 2-(2,4-dichlorophenyl)-2-(4H-1,2,4-triazol-4-ylmethyl)-, methanesulfonate (ester), (2R,4R)-rel-
- 1,3-Dioxolane-4-methanol, 2-(2,4-dichlorophenyl)-2-(4H-1,2,4-triazol-4-ylmethyl)-, methanesulfonate (ester), cis-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 3 products.
cis-[2-(2,4-Dichlorophenyl)-2-(1H-1,2,4-triazol-4-yl-methyl)-1,3-dioxolan-4-yl]methyl Methanesulfonate
CAS:Impurity Itraconazole Impurity 16
Applications cis-[2-(2,4-Dichlorophenyl)-2-(1H-1,2,4-triazol-4-yl-methyl)-1,3-dioxolan-4-yl]methyl Methanesulfonate (Itraconazole Impurity 16) is an impurity in the synthesis of Itraconazole (I937500), an orally active antimycotic structurally related to Ketoconazole. Antifungal.
References Espinel-Ingroff, A., et al.: Antimicrob. Agents Chemother., 26, 5 (1984), Heykants, J., et al.: Mycoses, 32, Suppl 1, 67 (1989);Formula:C14H15Cl2N3O5SColor and Shape:NeatMolecular weight:408.257


