
CAS 1036712-58-9
:6-Bromo-2-[(4-methoxyphenyl)methyl]-1(2H)-isoquinolinone
Description:
6-Bromo-2-[(4-methoxyphenyl)methyl]-1(2H)-isoquinolinone is a chemical compound characterized by its isoquinolinone core structure, which is a bicyclic compound featuring a fused benzene and pyridine ring. The presence of a bromine atom at the 6-position and a methoxyphenylmethyl group at the 2-position contributes to its unique reactivity and potential biological activity. This compound may exhibit properties such as fluorescence or photostability due to its aromatic components. It is likely to be soluble in organic solvents, reflecting the hydrophobic nature of its structure, while its polar methoxy group may enhance solubility in certain conditions. The compound's potential applications could span medicinal chemistry, particularly in drug development, where isoquinolinones are known for their diverse pharmacological activities. However, specific biological activities, toxicity, and environmental impact would require further investigation through empirical studies. As with any chemical substance, proper handling and safety protocols should be observed, especially given the presence of bromine, which can pose health risks.
Formula:C17H14BrNO2
InChI:InChI=1S/C17H14BrNO2/c1-21-15-5-2-12(3-6-15)11-19-9-8-13-10-14(18)4-7-16(13)17(19)20/h2-10H,11H2,1H3
InChI key:InChIKey=BTUPJEUTBPAUHV-UHFFFAOYSA-N
SMILES:O=C1C=2C(C=CN1CC3=CC=C(OC)C=C3)=CC(Br)=CC2
Synonyms:- 6-Bromo-2-[(4-methoxyphenyl)methyl]-1(2H)-isoquinolinone
- 1(2H)-Isoquinolinone, 6-bromo-2-[(4-methoxyphenyl)methyl]-
- 6-Bromo-2-(4-methoxybenzyl)-2H-isoquinolin-1-one
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.