CymitQuimica logo

CAS 1036755-97-1

:

2-Chloro-6-quinazolinol

Description:
2-Chloro-6-quinazolinol is a chemical compound characterized by its quinazolinol structure, which consists of a fused bicyclic system containing both a benzene and a pyrimidine ring. The presence of a chlorine atom at the 2-position and a hydroxyl group at the 6-position contributes to its unique reactivity and potential biological activity. This compound is typically a white to off-white solid and is soluble in organic solvents, with limited solubility in water. It may exhibit various pharmacological properties, making it of interest in medicinal chemistry and drug development. The chlorine substituent can influence the compound's lipophilicity and biological interactions, while the hydroxyl group may participate in hydrogen bonding, affecting its solubility and reactivity. As with many quinazolinol derivatives, 2-Chloro-6-quinazolinol may serve as a scaffold for the synthesis of more complex molecules, potentially leading to the discovery of new therapeutic agents. Safety and handling precautions should be observed, as with all chemical substances, due to potential toxicity and environmental impact.
Formula:C8H5ClN2O
InChI:InChI=1S/C8H5ClN2O/c9-8-10-4-5-3-6(12)1-2-7(5)11-8/h1-4,12H
InChI key:InChIKey=UNDBBQQPGZSXCD-UHFFFAOYSA-N
SMILES:OC1=CC2=C(N=C(Cl)N=C2)C=C1
Synonyms:
  • 2-Chloro-6-quinazolinol
  • 2-Chloroquinazolin-6-ol
  • 6-Quinazolinol, 2-chloro-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.