CymitQuimica logo

CAS 1036756-11-2

:

2-Amino-5-bromo-4-methoxybenzaldehyde

Description:
2-Amino-5-bromo-4-methoxybenzaldehyde is an organic compound characterized by its aromatic structure, which includes a benzaldehyde functional group, an amino group, a bromine atom, and a methoxy group. The presence of the amino group (-NH2) contributes to its potential as a building block in various synthetic applications, particularly in medicinal chemistry. The bromine atom enhances its reactivity, making it suitable for further functionalization through nucleophilic substitution reactions. The methoxy group (-OCH3) serves as an electron-donating substituent, influencing the compound's electronic properties and reactivity. This compound is typically used in the synthesis of more complex organic molecules and may exhibit biological activity, making it of interest in pharmaceutical research. Its solubility and stability can vary depending on the solvent and conditions, which are important considerations for its practical applications. Overall, 2-Amino-5-bromo-4-methoxybenzaldehyde is a versatile compound with significant implications in organic synthesis and potential therapeutic applications.
Formula:C8H8BrNO2
InChI:InChI=1S/C8H8BrNO2/c1-12-8-3-7(10)5(4-11)2-6(8)9/h2-4H,10H2,1H3
InChI key:InChIKey=ATTFTXASVWTGHE-UHFFFAOYSA-N
SMILES:C(=O)C1=C(N)C=C(OC)C(Br)=C1
Synonyms:
  • Benzaldehyde, 2-amino-5-bromo-4-methoxy-
  • 2-Amino-5-bromo-4-methoxybenzaldehyde
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.