CymitQuimica logo

CAS 1036757-10-4

:

2-Amino-5-bromo-4-chlorobenzenemethanol

Description:
2-Amino-5-bromo-4-chlorobenzenemethanol is an organic compound characterized by the presence of an amino group (-NH2), a bromine atom, and a chlorine atom attached to a benzene ring, along with a hydroxymethyl group (-CH2OH). This compound belongs to the class of substituted phenols and is notable for its potential applications in pharmaceuticals and agrochemicals due to the presence of multiple functional groups that can participate in various chemical reactions. The amino group can act as a nucleophile, while the halogen substituents (bromine and chlorine) can influence the compound's reactivity and solubility. The hydroxymethyl group contributes to its polarity, enhancing its solubility in polar solvents. Additionally, the presence of halogens can affect the compound's biological activity and interaction with other molecules. Overall, 2-Amino-5-bromo-4-chlorobenzenemethanol is a versatile compound with significant implications in synthetic chemistry and medicinal applications.
Formula:C7H7BrClNO
InChI:InChI=1S/C7H7BrClNO/c8-5-1-4(3-11)7(10)2-6(5)9/h1-2,11H,3,10H2
InChI key:InChIKey=TUYSJQDXRVTMSR-UHFFFAOYSA-N
SMILES:C(O)C1=C(N)C=C(Cl)C(Br)=C1
Synonyms:
  • Benzenemethanol, 2-amino-5-bromo-4-chloro-
  • 2-Amino-5-bromo-4-chlorobenzenemethanol
  • (2-Amino-5-bromo-4-chlorophenyl)methanol
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.