CAS 1036757-12-6

6-Bromo-7-chloro-2(1H)-quinazolinone

Description:

6-Bromo-7-chloro-2(1H)-quinazolinone is a heterocyclic organic compound characterized by its quinazolinone structure, which features a fused bicyclic system containing both benzene and pyrimidine rings. This compound is notable for its halogen substituents, specifically a bromine atom at the 6-position and a chlorine atom at the 7-position, which can influence its reactivity and biological activity. The presence of these halogens often enhances the compound's lipophilicity and can affect its interaction with biological targets. 6-Bromo-7-chloro-2(1H)-quinazolinone may exhibit various pharmacological properties, making it of interest in medicinal chemistry, particularly in the development of potential therapeutic agents. Its molecular structure allows for potential interactions with enzymes or receptors, which could lead to applications in treating diseases. Additionally, the compound's stability, solubility, and melting point are important characteristics that can influence its practical applications in research and industry. Overall, this compound represents a significant area of study within the field of organic and medicinal chemistry.

Formula: C₈H₄BrClN₂O

InChI: InChI=1S/C8H4BrClN2O/c9-5-1-4-3-11-8(13)12-7(4)2-6(5)10/h1-3H,(H,11,12,13)

InChI key: InChIKey=CTNDZOBVJZGQQF-UHFFFAOYSA-N

SMILES: ClC=1C=C2C(=CC1Br)C=NC(=O)N2

Synonyms:

• 6-Bromo-7-chloro-2(1H)-quinazolinone
• 2(1H)-Quinazolinone, 6-bromo-7-chloro-
• 6-Bromo-7-chloroquinazolin-2-ol