CymitQuimica logo

CAS 1036757-43-3

:

1-Isobutyl-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1H-pyrazole

Description:
1-Isobutyl-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1H-pyrazole is a chemical compound characterized by its unique structural features, which include a pyrazole ring and a boron-containing dioxaborolane moiety. The presence of the isobutyl group contributes to its hydrophobic characteristics, while the dioxaborolane unit enhances its reactivity and potential applications in organic synthesis, particularly in cross-coupling reactions. This compound is likely to exhibit moderate to high stability under standard conditions, but its reactivity can be influenced by the presence of functional groups and the steric hindrance introduced by the bulky tetramethyl substituents. Additionally, the compound may have applications in medicinal chemistry and materials science due to its potential as a ligand or building block in the synthesis of more complex molecules. Its solubility and behavior in various solvents would depend on the balance between its polar and non-polar characteristics, making it a versatile candidate for further research and development in chemical applications.
Formula:C13H23BN2O2
InChI:InChI=1S/C13H23BN2O2/c1-10(2)8-16-9-11(7-15-16)14-17-12(3,4)13(5,6)18-14/h7,9-10H,8H2,1-6H3
InChI key:InChIKey=YMEBZRNYQBODKB-UHFFFAOYSA-N
SMILES:CC1(C)OB(OC1(C)C)C2=CN(CC(C)C)N=C2
Synonyms:
  • 1-(2-Methylpropyl)-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrazole
  • 1-(2-Methylpropyl)-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1H-pyrazole
  • 1H-Pyrazole, 1-(2-methylpropyl)-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-
  • 1-Isobutyl-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1H-pyrazole
  • 1-Isobutylpyrazole-4-boronic acid pinacol ester
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.