CymitQuimica logo

CAS 1036761-91-7

:

N-(3-Bromophenyl)-1,3,4-thiadiazol-2-amine

Description:
N-(3-Bromophenyl)-1,3,4-thiadiazol-2-amine is a chemical compound characterized by its unique structure, which includes a thiadiazole ring and a bromophenyl group. The thiadiazole moiety contributes to its potential biological activity, as thiadiazoles are often found in various pharmacologically active compounds. The presence of the bromine atom in the phenyl group can enhance the compound's lipophilicity and influence its reactivity, making it a candidate for various chemical reactions and applications in medicinal chemistry. This compound may exhibit properties such as antimicrobial, antifungal, or anticancer activities, although specific biological activities would depend on further empirical studies. Additionally, its molecular structure suggests potential for interactions with biological targets, which could be explored in drug development. As with many organic compounds, safety and handling precautions should be observed, given the presence of bromine and the potential for toxicity. Overall, N-(3-Bromophenyl)-1,3,4-thiadiazol-2-amine represents a class of compounds with significant interest in research and development.
Formula:C8H6BrN3S
InChI:InChI=1S/C8H6BrN3S/c9-6-2-1-3-7(4-6)11-8-12-10-5-13-8/h1-5H,(H,11,12)
InChI key:InChIKey=BMEMTPUZIWPKMA-UHFFFAOYSA-N
SMILES:N(C1=CC(Br)=CC=C1)C2=NN=CS2
Synonyms:
  • N-(3-Bromophenyl)-1,3,4-thiadiazol-2-amine
  • 1,3,4-Thiadiazol-2-amine, N-(3-bromophenyl)-
  • (3-Bromo-phenyl)-[1,3,4]thiadiazol-2-yl-amine
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.