
CAS 1036761-97-3
:B-[3-[2-(Methylamino)-2-oxoethyl]phenyl]boronic acid
Description:
B-[3-[2-(Methylamino)-2-oxoethyl]phenyl]boronic acid, identified by its CAS number 1036761-97-3, is a boronic acid derivative characterized by the presence of a boron atom bonded to a phenyl group and an amino-substituted alkyl chain. This compound typically exhibits properties associated with boronic acids, such as the ability to form reversible covalent bonds with diols, making it useful in various applications, including organic synthesis and medicinal chemistry. The methylamino group contributes to its potential biological activity, possibly influencing its interaction with biological targets. Additionally, the presence of the carbonyl group in the side chain may enhance its reactivity and solubility in polar solvents. Overall, this compound's unique structure allows it to participate in diverse chemical reactions, including cross-coupling reactions, which are pivotal in the synthesis of complex organic molecules. Its specific characteristics, such as solubility, stability, and reactivity, can vary based on environmental conditions and the presence of other functional groups.
Formula:C9H12BNO3
InChI:InChI=1S/C9H12BNO3/c1-11-9(12)6-7-3-2-4-8(5-7)10(13)14/h2-5,13-14H,6H2,1H3,(H,11,12)
InChI key:InChIKey=UCWSNRRVIFRECL-UHFFFAOYSA-N
SMILES:C(C(NC)=O)C1=CC(B(O)O)=CC=C1
Synonyms:- Boronic acid, B-[3-[2-(methylamino)-2-oxoethyl]phenyl]-
- B-[3-[2-(Methylamino)-2-oxoethyl]phenyl]boronic acid
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.