CAS 1036762-00-1

B-[2-[(Tetrahydro-2H-pyran-4-yl)oxy]-4-pyridinyl]boronic acid

Description:

B-[2-[(Tetrahydro-2H-pyran-4-yl)oxy]-4-pyridinyl]boronic acid is a boronic acid derivative characterized by its unique structural features, which include a pyridine ring and a tetrahydro-2H-pyran moiety. This compound typically exhibits properties associated with boronic acids, such as the ability to form reversible covalent bonds with diols, making it valuable in various applications, including medicinal chemistry and organic synthesis. The presence of the pyridine ring contributes to its potential as a ligand in coordination chemistry, while the tetrahydro-2H-pyran group may enhance its solubility and stability in biological systems. Additionally, boronic acids are known for their role in drug discovery, particularly in the development of proteasome inhibitors and other therapeutic agents. The compound's reactivity and functionalization potential make it a subject of interest in the fields of organic and medicinal chemistry. Overall, B-[2-[(Tetrahydro-2H-pyran-4-yl)oxy]-4-pyridinyl]boronic acid represents a versatile chemical entity with promising applications in research and development.

Formula: C₁₀H₁₄BNO₄

InChI: InChI=1S/C10H14BNO4/c13-11(14)8-1-4-12-10(7-8)16-9-2-5-15-6-3-9/h1,4,7,9,13-14H,2-3,5-6H2

InChI key: InChIKey=JMSJBOIROKJFHD-UHFFFAOYSA-N

SMILES: O(C1=CC(B(O)O)=CC=N1)C2CCOCC2

Synonyms:

• B-[2-[(Tetrahydro-2H-pyran-4-yl)oxy]-4-pyridinyl]boronic acid
• 2-(Tetrahydro-pyran-4-yloxy)-4-pyridinylboronic acid
• Boronic acid, B-[2-[(tetrahydro-2H-pyran-4-yl)oxy]-4-pyridinyl]-
• [2-(Oxan-4-yloxy)pyridin-4-yl]boronic acid
• (2-((Tetrahydro-2H-pyran-4-yl)oxy)pyridin-4-yl)boronic acid

(2-((Tetrahydro-2H-pyran-4-yl)oxy)pyridin-4-yl)boronic acid

CAS: 1036762-00-1

Formula: C₁₀H₁₄BNO₄

Molecular weight: 223.0335

Ref: IN-DA00HA5N