CAS 103694-26-4: C-(2-METHYL-THIAZOL-4-YL)-METHYLAMINE
Description:C-(2-Methyl-thiazol-4-yl)-methylamine, identified by its CAS number 103694-26-4, is an organic compound characterized by the presence of a thiazole ring, which is a five-membered heterocyclic structure containing both sulfur and nitrogen atoms. The compound features a methylamine group, indicating the presence of an amine functional group attached to a methyl group. This structure contributes to its potential as a building block in pharmaceutical chemistry, particularly in the development of biologically active molecules. The thiazole moiety is known for its role in various biological activities, including antimicrobial and antifungal properties. The compound is likely to exhibit moderate solubility in polar solvents due to the presence of the amine group, which can engage in hydrogen bonding. Additionally, its molecular structure suggests potential reactivity, making it a candidate for further chemical modifications. Safety and handling precautions should be observed, as with any chemical substance, particularly in laboratory settings.
Formula:C5H8N2S
InChI:InChI=1/C5H8N2S/c1-4-7-5(2-6)3-8-4/h3H,2,6H2,1H3
- Synonyms:
- Rarechem Al Bw 0694
- 4-Aminomethyl-2-Methyl-1,3-Thiazole
- 2-Methyl-1,3-Thiazole-4-Methylamine
- Chembrdg-Bb 4101061
- (2-Methyl-1,3-Thiazol-4-Yl)Methylamine
- (2-Methylthiazol-4-Yl)Methylamine
- 1-(2-Methyl-1,3-Thiazol-4-Yl)Methanamine
| Brand | Product data | Purity | Price range | Estimated delivery |
|---|---|---|---|---|
 | 2-Methyl-1,3-thiazole-4-methylamine REF: IN-DA007FW4CAS: 103694-26-4 | 98% | To inquire | Wed 16 Apr 25 |
 | 4-(Aminomethyl)-2-methyl-1,3-thiazole REF: 54-OR6203CAS: 103694-26-4 | 97% | To inquire | Wed 23 Apr 25 |
 | 2-Methyl-1,3-thiazole-4-methylamine REF: 10-F065498CAS: 103694-26-4 | 98% | - - - | Discontinued product |
 | (2-Methylthiazol-4-yl)methylamine REF: 3D-FM36265CAS: 103694-26-4 | Min. 95% | - - - | Discontinued product |
2-Methyl-1,3-thiazole-4-methylamine
Ref: IN-DA007FW4
| 1g | To inquire | ||
| 100mg | 176.00 € | ||
| 250mg | 292.00 € |
4-(Aminomethyl)-2-methyl-1,3-thiazole
Ref: 54-OR6203
| Undefined size | To inquire |
2-Methyl-1,3-thiazole-4-methylamine
Ref: 10-F065498
| 1g | Discontinued | Request information | |
| 5g | Discontinued | Request information | |
| 10g | Discontinued | Request information | |
| 2.5g | Discontinued | Request information | |
| 250mg | Discontinued | Request information |
(2-Methylthiazol-4-yl)methylamine
Ref: 3D-FM36265
| 1g | Discontinued | Request information | |
| 2g | Discontinued | Request information | |
| 5g | Discontinued | Request information | |
| 250mg | Discontinued | Request information | |
| 500mg | Discontinued | Request information |
