CAS 103694-27-5
:4-Amino-5-pyrimidinemethanamine
Description:
4-Amino-5-pyrimidinemethanamine, with the CAS number 103694-27-5, is an organic compound characterized by its pyrimidine ring structure, which is a six-membered aromatic ring containing two nitrogen atoms at positions 1 and 3. This compound features an amino group (-NH2) and a methanamine group (-CH2NH2) attached to the pyrimidine ring, contributing to its basicity and potential reactivity. It is typically a white to off-white solid and is soluble in polar solvents, reflecting its amine functional groups. The presence of multiple amino groups suggests that it may participate in hydrogen bonding and can act as a ligand in coordination chemistry. This compound may have applications in pharmaceuticals, particularly in the synthesis of biologically active molecules, due to its structural similarity to nucleobases and its potential role in various biochemical pathways. As with many amines, it may exhibit basic properties and can be protonated in acidic conditions, influencing its behavior in different chemical environments.
Formula:C5H8N4
InChI:InChI=1S/C5H8N4/c6-1-4-2-8-3-9-5(4)7/h2-3H,1,6H2,(H2,7,8,9)
InChI key:InChIKey=MKYITYRIURYLEQ-UHFFFAOYSA-N
SMILES:C(N)C=1C(N)=NC=NC1
Synonyms:- 4-Amino-5-(aminomethyl)pyrimidine
- Pyrimidine, 4-amino-5-(aminomethyl)-
- 4-Amino-5-pyrimidinemethylamine
- 4-Amino-5-pyrimidinemethanamine
- 5-Pyrimidinemethanamine, 4-amino-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
