CAS 103698-09-5
:3-Nitro-4-pyridinecarbonitrile
Description:
3-Nitro-4-pyridinecarbonitrile, with the CAS number 103698-09-5, is a chemical compound characterized by its pyridine ring, which is a six-membered aromatic heterocycle containing one nitrogen atom. This compound features a nitro group (-NO2) and a cyano group (-C≡N) attached to the pyridine ring, contributing to its reactivity and potential applications in various chemical processes. The presence of the nitro group typically enhances the electrophilic character of the molecule, making it useful in synthetic organic chemistry. Additionally, the cyano group can participate in nucleophilic reactions, further expanding its utility. 3-Nitro-4-pyridinecarbonitrile is often studied for its potential applications in pharmaceuticals, agrochemicals, and materials science due to its unique electronic properties and functional groups. As with many nitro-containing compounds, it may exhibit specific safety and handling considerations, necessitating proper precautions during use. Overall, this compound represents a versatile building block in organic synthesis and research.
Formula:C6H3N3O2
InChI:InChI=1S/C6H3N3O2/c7-3-5-1-2-8-4-6(5)9(10)11/h1-2,4H
InChI key:InChIKey=WQSGWOANQDEUHL-UHFFFAOYSA-N
SMILES:C(#N)C=1C(N(=O)=O)=CN=CC1
Synonyms:- 4-Cyano-3-nitropyridine
- 3-Nitro-4-pyridinecarbonitrile
- 4-Pyridinecarbonitrile, 3-nitro-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
