CAS 1036990-69-8

Imidazo[1,2-a]pyridine-7-carboxamide

Description:

Imidazo[1,2-a]pyridine-7-carboxamide is a heterocyclic organic compound characterized by its fused imidazole and pyridine rings, which contribute to its unique chemical properties. This compound typically features a carboxamide functional group at the 7-position of the imidazo[1,2-a]pyridine structure, enhancing its potential for hydrogen bonding and solubility in polar solvents. The presence of nitrogen atoms in the ring system can influence its reactivity and interaction with biological targets, making it of interest in medicinal chemistry. Imidazo[1,2-a]pyridine derivatives are often studied for their pharmacological activities, including anti-inflammatory, antimicrobial, and anticancer properties. The compound's molecular structure allows for various modifications, which can lead to a diverse range of biological activities. Additionally, its stability and solubility characteristics can be influenced by the specific substituents on the ring system, making it a versatile scaffold in drug design and development. Overall, Imidazo[1,2-a]pyridine-7-carboxamide represents a significant class of compounds with potential applications in pharmaceuticals and biochemistry.

Formula: C₈H₇N₃O

InChI: InChI=1S/C8H7N3O/c9-8(12)6-1-3-11-4-2-10-7(11)5-6/h1-5H,(H2,9,12)

InChI key: InChIKey=ZQLZNGUJOGWVCB-UHFFFAOYSA-N

SMILES: C(N)(=O)C1=CC=2N(C=C1)C=CN2

Synonyms:

• Imidazo[1,2-a]pyridine-7-carboxamide