CAS 1037-31-6
:Nsc405511
Description:
The chemical substance known as Nsc405511, with the CAS number 1037-31-6, is a compound that has been studied primarily for its potential applications in medicinal chemistry. It is characterized by its specific molecular structure, which includes various functional groups that contribute to its biological activity. Typically, compounds like Nsc405511 are evaluated for their pharmacological properties, including their efficacy and safety profiles in biological systems. The substance may exhibit properties such as solubility in organic solvents, stability under certain conditions, and reactivity with other chemical entities. Additionally, it may have specific interactions with biological targets, making it of interest in drug discovery and development. However, detailed information regarding its physical and chemical properties, such as melting point, boiling point, and spectral data, would require access to specialized databases or scientific literature for comprehensive analysis. Overall, Nsc405511 represents a class of compounds that are crucial in the ongoing research within the field of chemistry and pharmacology.
Formula:C13H8N2O6
InChI:InChI=1/C13H8N2O6/c16-13(9-1-3-10(4-2-9)14(17)18)21-12-7-5-11(6-8-12)15(19)20/h1-8H
Synonyms:- benzoic acid, 4-nitro-, 4-nitrophenyl ester
- Phenol, p-nitro-, p-nitro-benzoate
- Benzoic acid, 4-nitro-, 4-nitrophenyl ester (9CI, ACI)
- Benzoic acid, 4-nitro-, 4-nitrophenyl ester
- Nsc405511
- 4-nitro-Benzoic acid 4-nitrophenyl ester (9CI ACI)
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 1 products.
4-Nitrophenyl 4-nitrobenzoate
CAS:4-Nitrophenyl 4-nitrobenzoatePurity:98%Molecular weight:288.22g/mol

