CAS 10371-86-5

9-Methoxy-5,11-dimethyl-6H-pyrido[4,3-b]carbazole

Description:

9-Methoxy-5,11-dimethyl-6H-pyrido[4,3-b]carbazole, with the CAS number 10371-86-5, is a heterocyclic organic compound that belongs to the class of carbazoles. This compound features a fused ring system that includes a pyridine and a carbazole moiety, contributing to its unique chemical properties. It is characterized by the presence of methoxy and methyl substituents, which can influence its solubility, reactivity, and biological activity. The methoxy group typically enhances the compound's lipophilicity, while the dimethyl groups can affect its electronic properties. This compound may exhibit interesting pharmacological activities, making it a subject of research in medicinal chemistry. Its structural features suggest potential applications in organic electronics, photochemistry, and as a fluorescent probe. However, detailed studies on its specific properties, such as melting point, boiling point, and spectral characteristics, would be necessary to fully understand its behavior in various chemical contexts. Overall, 9-Methoxy-5,11-dimethyl-6H-pyrido[4,3-b]carbazole represents a complex structure with potential utility in various scientific fields.

Formula: C₁₈H₁₆N₂O

InChI: InChI=1S/C18H16N2O/c1-10-15-9-19-7-6-13(15)11(2)18-17(10)14-8-12(21-3)4-5-16(14)20-18/h4-9,20H,1-3H3

InChI key: InChIKey=BKRMCDAOAQWNTG-UHFFFAOYSA-N

SMILES: CC1=C2C=3C(NC2=C(C)C=4C1=CN=CC4)=CC=C(OC)C3

Synonyms:

• NSC 69187
• 9-Methoxy-5,11-dimethyl-6H-pyrido[4,3-b]carbazole
• 9-Methoxyellipticine
• 9-Methoxyellipticin
• 6H-Pyrido[4,3-b]carbazole, 9-methoxy-5,11-dimethyl-

9-Methoxyellipticine

CAS: 10371-86-5

9-Methoxyellipticine is a natural alkaloid and potent c-Kit kinase inhibitor exhibiting cytotoxic properties for leukaemia research.

Formula: C₁₈H₁₆N₂O

Color and Shape: Solid

Molecular weight: 276.33

Ref: TM-T36699