CAS 103711-21-3

2,2-Diaminoacetic acid

Description:

2,2-Diaminoacetic acid, also known as DAA, is an amino acid characterized by the presence of two amino groups and one carboxylic acid group in its structure. This compound is a derivative of glycine, where two amino groups are attached to the second carbon atom. It is typically a white crystalline solid that is soluble in water, reflecting its polar nature due to the amino and carboxylic acid functional groups. The presence of multiple amino groups allows for potential applications in biochemistry and pharmaceuticals, particularly in the synthesis of peptides and as a building block for various biochemical processes. Additionally, 2,2-Diaminoacetic acid may exhibit properties such as chelation with metal ions, which can be useful in various chemical applications. Its CAS number, 103711-21-3, is a unique identifier that facilitates the identification and study of this compound in scientific literature and databases. As with many amino acids, it may also play a role in biological systems, although its specific biological functions and interactions would require further investigation.

Formula: C₂H₆N₂O₂

InChI: InChI=1S/C2H6N2O2/c3-1(4)2(5)6/h1H,3-4H2,(H,5,6)

InChI key: InChIKey=MAEDLSNGVQYGPK-UHFFFAOYSA-N

SMILES: C(C(O)=O)(N)N

Synonyms:

• Acetic acid, diamino-
• Acetic acid, 2,2-diamino-
• 2,2-Diaminoacetic acid
• Diaminoacetic acid

2,2-Diaminoacetic Acid

Controlled Product

CAS: 103711-21-3

Formula: C₂H₆N₂O₂

Color and Shape: Neat

Molecular weight: 90.081

Ref: TR-D416143