CAS 1037240-01-9

(2Z)-2-[(2,4-Dichlorophenyl)methylene]-1-azabicyclo[2.2.2]octan-3-ol

Description:

The chemical substance known as (2Z)-2-[(2,4-Dichlorophenyl)methylene]-1-azabicyclo[2.2.2]octan-3-ol, with the CAS number 1037240-01-9, is a bicyclic compound featuring a nitrogen atom within its structure, indicative of its classification as an azabicyclo compound. This substance contains a dichlorophenyl group, which contributes to its potential biological activity and lipophilicity. The presence of the hydroxyl (-OH) group suggests that it may exhibit polar characteristics, influencing its solubility and reactivity. The specific stereochemistry indicated by the (2Z) configuration implies a particular geometric arrangement around the double bond, which can significantly affect the compound's interactions and properties. Such compounds are often of interest in medicinal chemistry due to their potential pharmacological applications, including as inhibitors or modulators in various biological pathways. Overall, the unique structural features of this compound may lead to interesting chemical behavior and biological activity, warranting further investigation in research contexts.

Formula: C₁₄H₁₅Cl₂NO

InChI: InChI=1/C14H15Cl2NO/c15-11-2-1-10(12(16)8-11)7-13-14(18)9-3-5-17(13)6-4-9/h1-2,7-9,14,18H,3-6H2/b13-7-

InChI key: InChIKey=XAHDHBCPTITANJ-QPEQYQDCNA-N

SMILES: C(=C/1\N2CCC(C1O)CC2)\C3=C(Cl)C=C(Cl)C=C3

Synonyms:

• 1-Azabicyclo[2.2.2]octan-3-ol, 2-[(2,4-dichlorophenyl)methylene]-, (2Z)-
• (2Z)-2-[(2,4-Dichlorophenyl)methylene]-1-azabicyclo[2.2.2]octan-3-ol