CAS 103725-47-9: N-[2-(Benzoylthio)acetyl]glycylglycylglycine

Description:N-[2-(Benzoylthio)acetyl]glycylglycylglycine, identified by its CAS number 103725-47-9, is a synthetic compound that belongs to the class of peptides and derivatives. This substance features a glycine backbone, which is a simple amino acid, modified with a benzoylthioacetyl group. The presence of the benzoylthio moiety suggests potential applications in medicinal chemistry, particularly in drug design, due to its ability to interact with biological targets. The compound's structure indicates it may exhibit properties such as solubility in organic solvents and potential reactivity due to the functional groups present. Its peptide nature implies that it could participate in various biochemical processes, possibly influencing protein synthesis or enzyme activity. Additionally, the compound may have implications in research related to peptide synthesis and modification, as well as in the development of therapeutic agents. However, specific biological activities, toxicity, and pharmacokinetic properties would require further investigation through empirical studies.

Formula:C₁₅H₁₇N₃O₆S

InChI:InChI=1S/C15H17N3O6S/c19-11(16-6-12(20)18-8-14(22)23)7-17-13(21)9-25-15(24)10-4-2-1-3-5-10/h1-5H,6-9H2,(H,16,19)(H,17,21)(H,18,20)(H,22,23)

InChI key:InChIKey=VDPYMEBVIDZKMD-UHFFFAOYSA-N

SMILES:O=C(SCC(=O)NCC(=O)NCC(=O)NCC(=O)O)C=1C=CC=CC1