
CAS 1037298-25-1
:2-Amino-5-fluoro-4-iodophenol
Description:
2-Amino-5-fluoro-4-iodophenol is an organic compound characterized by the presence of an amino group, a fluorine atom, and an iodine atom attached to a phenolic structure. This compound features a phenol ring, which is a benzene ring with a hydroxyl (-OH) group, and it is substituted at the 2, 4, and 5 positions with an amino group (-NH2), a fluorine atom (F), and an iodine atom (I), respectively. The presence of these halogen substituents can significantly influence the compound's reactivity, solubility, and biological activity. Typically, compounds like this may exhibit properties such as being a potential intermediate in organic synthesis or having applications in pharmaceuticals or agrochemicals. The specific interactions and stability of 2-Amino-5-fluoro-4-iodophenol can be affected by factors such as pH, temperature, and the presence of other chemical species. As with many halogenated compounds, it is essential to consider environmental and safety aspects during handling and disposal.
Formula:C6H5FINO
InChI:InChI=1S/C6H5FINO/c7-3-1-6(10)5(9)2-4(3)8/h1-2,10H,9H2
InChI key:InChIKey=YODVHBXBACNADC-UHFFFAOYSA-N
SMILES:FC1=C(I)C=C(N)C(O)=C1
Synonyms:- 2-Amino-5-fluoro-4-iodophenol
- Phenol, 2-amino-5-fluoro-4-iodo-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.