CAS 103733-32-0

3-Isoquinolinecarboxylic acid, 1,2,3,4-tetrahydro-6,7-dimethoxy-, phenylmethyl ester, hydrochloride, (3S)-

Description:

3-Isoquinolinecarboxylic acid, 1,2,3,4-tetrahydro-6,7-dimethoxy-, phenylmethyl ester, hydrochloride, (3S)- is a chemical compound characterized by its isoquinoline structure, which is a bicyclic aromatic compound. This substance features a carboxylic acid functional group, indicating its potential acidity and reactivity in various chemical reactions. The presence of methoxy groups (–OCH3) enhances its solubility and may influence its biological activity. The tetrahydro configuration suggests that the compound has a saturated ring system, which can affect its conformational properties and interactions with biological targets. As a hydrochloride salt, it is typically more stable and soluble in aqueous solutions, making it suitable for pharmaceutical applications. The (3S)- designation indicates its specific stereochemistry, which is crucial for its biological activity and interaction with receptors or enzymes. Overall, this compound may exhibit interesting pharmacological properties, making it a subject of interest in medicinal chemistry and drug development.

Formula: C₁₉H₂₁NO₄·ClH

InChI: InChI=1S/C19H21NO4.ClH/c1-22-17-9-14-8-16(20-11-15(14)10-18(17)23-2)19(21)24-12-13-6-4-3-5-7-13;/h3-7,9-10,16,20H,8,11-12H2,1-2H3;1H/t16-;/m0./s1

InChI key: InChIKey=GQDUPSRSUSSQLG-NTISSMGPSA-N

SMILES: C(OCC1=CC=CC=C1)(=O)[C@@H]2CC=3C(=CC(OC)=C(OC)C3)CN2.Cl

Synonyms:

• 3-Isoquinolinecarboxylic acid, 1,2,3,4-tetrahydro-6,7-dimethoxy-, phenylmethyl ester, hydrochloride, (3S)-
• 3-Isoquinolinecarboxylic acid, 1,2,3,4-tetrahydro-6,7-dimethoxy-, phenylmethyl ester, hydrochloride, (S)-