CAS 103744-86-1
:Terflavin b
Description:
Terflavin B, with the CAS number 103744-86-1, is a naturally occurring compound classified as a flavonoid. It is primarily derived from certain plant sources and is known for its potential biological activities, including antioxidant, anti-inflammatory, and antimicrobial properties. Terflavin B exhibits a complex structure characterized by multiple hydroxyl groups, which contribute to its reactivity and interaction with various biological systems. This compound has garnered interest in pharmacological research due to its potential therapeutic applications, particularly in the fields of cancer treatment and cardiovascular health. Additionally, its role in modulating cellular signaling pathways makes it a subject of study in the context of natural product chemistry. While research is ongoing, the full extent of its biological effects and mechanisms of action is still being explored, highlighting the importance of further investigation into its pharmacokinetics and safety profile.
Formula:C34H24O22
InChI:InChI=1S/C34H24O22/c35-5-14(40)24(45)28(15(41)6-53-31(49)7-1-10(36)21(42)11(37)2-7)54-32(50)8-3-12(38)22(43)25(46)16(8)18-20-19-17-9(33(51)55-30(19)27(48)26(18)47)4-13(39)23(44)29(17)56-34(20)52/h1-5,14-15,24,28,36-48H,6H2
InChI key:InChIKey=YGKOLDGLIDJBHH-UHFFFAOYSA-N
SMILES:O=C1C=2C=3C4=C(O1)C(O)=C(O)C=C4C(=O)OC3C(O)=C(O)C2C5=C(C(OC(C(COC(=O)C6=CC(O)=C(O)C(O)=C6)O)C(C(C=O)O)O)=O)C=C(O)C(O)=C5O
Synonyms:- <span class="text-smallcaps">D</span>-Glucose, 4-[(2S)-2-(5,10-dihydro-2,3,7,8-tetrahydroxy-5,10-dioxo[1]benzopyrano[5,4,3-cde][1]benzopyran-1-yl)-3,4,5-trihydroxybenzoate] 6-(3,4,5-trihydroxybenzoate)
- <span class="text-smallcaps">D</span>-Glucose, 4-[2-(5,10-dihydro-2,3,7,8-tetrahydroxy-5,10-dioxo[1]benzopyrano[5,4,3-cde][1]benzopyran-1-yl)-3,4,5-trihydroxybenzoate] 6-(3,4,5-trihydroxybenzoate), (S)-
- D-Glucose,4-[2-(5,10-dihydro-2,3,7,8-tetrahydroxy-5,10-dioxo[1]benzopyrano[5,4,3-cde][1]benzopyran-1-yl)-3,4,5-trihydroxybenzoate]6-(3,4,5-trihydroxybenzoate), (S)-
- Terflavin b
- [1]Benzopyrano[5,4,3-cde][1]benzopyran, <span class="text-smallcaps">D</span>-glucose deriv.
- [1]Benzopyrano[5,4,3-cde][1]benzopyran,D-glucose deriv.
- D-Glucose, 4-[(2S)-2-(5,10-dihydro-2,3,7,8-tetrahydroxy-5,10-dioxo[1]benzopyrano[5,4,3-cde][1]benzopyran-1-yl)-3,4,5-trihydroxybenzoate] 6-(3,4,5-trihydroxybenzoate)
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 1 products.
Terflavin B
CAS:Controlled ProductTerflavin B is a natural product that has been shown to have autophagy-inducing properties. Terflavin B induces autophagy by increasing the metabolic rate and inhibiting the synthesis of proteins. This product has been shown to increase the cancer cell's sensitivity to chemotherapy, which may be due to its ability to induce reactive oxygen species. In addition, terflavin B can protect against drug interactions by inhibiting the activity of cytochrome P450 enzymes. It also inhibits the growth of resistant microorganisms such as chronic kidney and bladder infections. Terflavin B contains tannins and ellagitannins, which have antimicrobial activities that are effective against bacteria, yeast, and fungi.Formula:C34H24O22Purity:Min 90%Color and Shape:PowderMolecular weight:784.54 g/mol
