CymitQuimica logo

CAS 1037479-62-1

:

4,6-dichloro-1-(tetrahydro-2H-pyran-2-yl)-1H-pyrazolo[3,4-d]pyrimidine

Description:
4,6-Dichloro-1-(tetrahydro-2H-pyran-2-yl)-1H-pyrazolo[3,4-d]pyrimidine is a heterocyclic compound characterized by its complex structure, which includes a pyrazolo-pyrimidine core substituted with chlorine atoms and a tetrahydro-pyran moiety. This compound typically exhibits properties associated with heterocycles, such as potential biological activity, making it of interest in medicinal chemistry. The presence of chlorine substituents can influence its reactivity and solubility, while the tetrahydro-pyran group may enhance its lipophilicity and ability to interact with biological targets. The compound's molecular structure suggests it may participate in various chemical reactions, including nucleophilic substitutions and cycloadditions. Its unique arrangement of atoms and functional groups may also confer specific pharmacological properties, potentially making it a candidate for drug development. As with many heterocyclic compounds, its synthesis and characterization would involve standard organic chemistry techniques, and its stability and reactivity would be influenced by the electronic effects of the substituents present.
Formula:C10H10Cl2N4O
InChI:InChI=1S/C10H10Cl2N4O/c11-8-6-5-13-16(7-3-1-2-4-17-7)9(6)15-10(12)14-8/h5,7H,1-4H2
InChI key:VMIPTJUFAWNUEU-UHFFFAOYSA-N
SMILES:C1CCOC(C1)N2C3=C(C=N2)C(=NC(=N3)Cl)Cl
Synonyms:
  • 4,6-dichloro-1-(oxan-2-yl)-1H-pyrazolo[3,4-d]pyrimidine
  • 1H-Pyrazolo[3,4-d]pyrimidine, 4,6-dichloro-1-(tetrahydro-2H-pyran-2-yl)-
  • 4,6-dichloro-1-(tetrahydro-2H-pyran-2-yl)-1H-pyrazolo[3,4-d]pyrimidine
  • 4,6-dichloro-1-(tetrahydro-2H-pyran-2-yl)-1H-pyrazolo[3,4-d]pyrimidine ISO 9001:2015 REACH
Found 4 products.