CAS 103748-27-2
:2-Nitro-N-(2-phenoxyethyl)benzenamine
Description:
2-Nitro-N-(2-phenoxyethyl)benzenamine is an organic compound characterized by its aromatic structure, which includes a nitro group (-NO2) and an amine group (-NH2) attached to a benzene ring. The presence of the phenoxyethyl group contributes to its overall hydrophobic character, influencing its solubility and reactivity. This compound typically exhibits moderate to high stability under standard conditions but may be sensitive to strong acids or bases, which can affect the amine functionality. The nitro group can participate in electrophilic aromatic substitution reactions, making the compound a potential candidate for further chemical modifications. Additionally, due to the presence of both the nitro and amine groups, it may exhibit interesting electronic properties, which can be exploited in various applications, including pharmaceuticals and agrochemicals. Safety data should be consulted, as nitro compounds can sometimes pose health risks, including toxicity and environmental hazards. Proper handling and storage conditions are essential to ensure safety when working with this substance.
Formula:C14H14N2O3
InChI:InChI=1S/C14H14N2O3/c17-16(18)14-9-5-4-8-13(14)15-10-11-19-12-6-2-1-3-7-12/h1-9,15H,10-11H2
InChI key:InChIKey=PZJKHRQJHJKAFS-UHFFFAOYSA-N
SMILES:N(CCOC1=CC=CC=C1)C2=C(N(=O)=O)C=CC=C2
Synonyms:- 2-Nitro-N-(2-phenoxyethyl)benzenamine
- Benzenamine, 2-nitro-N-(2-phenoxyethyl)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.