CAS 103755-52-8: Quinoline, 6-hydrazinyl-, hydrochloride (1:2)
Description:Quinoline, 6-hydrazinyl-, hydrochloride (1:2) is a chemical compound characterized by its hydrazine functional group attached to a quinoline ring system. This compound typically appears as a crystalline solid and is soluble in water due to the presence of the hydrochloride salt form, which enhances its solubility and stability. Quinoline derivatives are known for their diverse biological activities, including potential applications in pharmaceuticals and agrochemicals. The hydrazinyl group may impart specific reactivity, making it useful in various synthetic pathways, particularly in the formation of hydrazones or as a precursor in the synthesis of other nitrogen-containing compounds. The hydrochloride form indicates that the compound is a salt, which can influence its physical properties, such as melting point and solubility. Safety data should be consulted, as compounds containing hydrazine derivatives can be toxic and potentially carcinogenic. Overall, Quinoline, 6-hydrazinyl-, hydrochloride (1:2) represents an interesting compound in the realm of organic chemistry with potential applications in medicinal chemistry.
Formula:C9H9N3·2ClH
InChI:InChI=1S/C9H9N3.2ClH/c10-12-8-3-4-9-7(6-8)2-1-5-11-9;;/h1-6,12H,10H2;2*1H
InChI key:InChIKey=WWUVKHLYLOXKLJ-UHFFFAOYSA-N
SMILES:Cl.N1=CC=CC2=CC(=CC=C12)NN
- Synonyms:
- Quinoline, 6-hydrazino-, dihydrochloride
- Quinoline, 6-hydrazinyl-, hydrochloride (1:2)
| Brand | Product data | Purity | Price range | Estimated delivery |
|---|---|---|---|---|
 | 6-Hydrazinoquinoline dihydrochloride REF: IN-DA007FTHCAS: 103755-52-8 | 95% | 27.00 €~110.00 € | Mon 03 Mar 25 |
 | 6-Hydrazinoquinoline dihydrochloride REF: 54-OR96159CAS: 103755-52-8 | 0.95 | 244.00 € | Tue 04 Mar 25 |
 | 6-Hydrazinoquinoline dihydrochloride REF: 10-F695076CAS: 103755-52-8 | 97% | 109.00 € | Tue 04 Mar 25 |
| 6-Hydrazinylquinoline hydrochloride REF: 10-F233073CAS: 103755-52-8 | 95.0% | - - - | Discontinued product |
 | 6-Hydrazinylquinoline dihydrochloride REF: 3D-FH43292CAS: 103755-52-8 | Min. 95% | - - - | Discontinued product |
6-Hydrazinoquinoline dihydrochloride
Ref: IN-DA007FTH
| 1g | 49.00 € | ||
| 5g | 110.00 € | ||
| 250mg | 27.00 € |
Ref: 10-F695076
| 5g | 109.00 € |
6-Hydrazinylquinoline hydrochloride
Ref: 10-F233073
| 1g | Discontinued | Request information | |
| 250mg | Discontinued | Request information |
6-Hydrazinylquinoline dihydrochloride
Ref: 3D-FH43292
| Undefined size | Discontinued | Request information |
