CAS 103755-57-3
:3-(4-aminophenyl)-1,4-dihydropyrazol-5-one
Description:
3-(4-Aminophenyl)-1,4-dihydropyrazol-5-one, with the CAS number 103755-57-3, is a chemical compound characterized by its pyrazolone structure, which features a dihydropyridine ring and an amino group attached to a phenyl ring. This compound typically exhibits properties such as being a solid at room temperature, with potential applications in pharmaceuticals due to its bioactive nature. The presence of the amino group suggests it may participate in hydrogen bonding, influencing its solubility and reactivity. Additionally, the compound may exhibit antioxidant and anti-inflammatory properties, making it of interest in medicinal chemistry. Its molecular structure allows for various functional modifications, which can enhance its therapeutic efficacy or alter its pharmacokinetic properties. As with many organic compounds, its stability and reactivity can be influenced by environmental factors such as pH and temperature. Overall, 3-(4-aminophenyl)-1,4-dihydropyrazol-5-one represents a versatile scaffold for further chemical exploration and development in drug design.
Formula:C9H9N3O
InChI:InChI=1/C9H9N3O/c10-7-3-1-6(2-4-7)8-5-9(13)12-11-8/h1-4H,5,10H2,(H,12,13)
SMILES:c1cc(ccc1C1=NN=C(C1)O)N
Synonyms:- 3H-pyrazol-3-one, 5-(4-aminophenyl)-2,4-dihydro-
- 5-(4-aminophenyl)-2,4-dihydro-3H-pyrazol-3-one
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
