
CAS 1037589-70-0
:N2-[(9H-Fluoren-9-ylmethoxy)carbonyl]-N6-[1-oxo-3-[(triphenylmethyl)thio]propyl]-L-lysine
Description:
N2-[(9H-Fluoren-9-ylmethoxy)carbonyl]-N6-[1-oxo-3-[(triphenylmethyl)thio]propyl]-L-lysine, with the CAS number 1037589-70-0, is a synthetic compound that belongs to the class of modified amino acids. This compound features a lysine backbone, which is an essential amino acid, modified with a fluorenylmethoxycarbonyl (Fmoc) protecting group and a triphenylmethyl thioether moiety. The Fmoc group is commonly used in peptide synthesis as a protective group for the amino functionality, allowing for selective reactions without interfering with the lysine side chain. The presence of the triphenylmethyl thio group introduces significant steric bulk and hydrophobic characteristics, which can influence the compound's solubility and reactivity. This compound is typically utilized in biochemical research, particularly in the synthesis of peptides and proteins, where it can serve as a building block or a protective intermediate. Its unique structural features make it valuable for studying protein interactions and modifications in various biochemical applications.
Formula:C43H42N2O5S
InChI:InChI=1S/C43H42N2O5S/c46-40(27-29-51-43(31-16-4-1-5-17-31,32-18-6-2-7-19-32)33-20-8-3-9-21-33)44-28-15-14-26-39(41(47)48)45-42(49)50-30-38-36-24-12-10-22-34(36)35-23-11-13-25-37(35)38/h1-13,16-25,38-39H,14-15,26-30H2,(H,44,46)(H,45,49)(H,47,48)/t39-/m0/s1
InChI key:InChIKey=RDDYYMRTBHTZGO-KDXMTYKHSA-N
SMILES:C(SCCC(NCCCC[C@H](NC(OCC1C=2C(C=3C1=CC=CC3)=CC=CC2)=O)C(O)=O)=O)(C4=CC=CC=C4)(C5=CC=CC=C5)C6=CC=CC=C6
Synonyms:- N2-[(9H-Fluoren-9-ylmethoxy)carbonyl]-N6-[1-oxo-3-[(triphenylmethyl)thio]propyl]-L-lysine
- L-Lysine, N2-[(9H-fluoren-9-ylmethoxy)carbonyl]-N6-[1-oxo-3-[(triphenylmethyl)thio]propyl]-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.