
CAS 10376-59-7
:3-(2-Hydroxyethyl)-2-methyl-3,4-dihydro-4-quinazolinone
Description:
3-(2-Hydroxyethyl)-2-methyl-3,4-dihydro-4-quinazolinone, with the CAS number 10376-59-7, is a chemical compound that belongs to the quinazolinone class, which is characterized by a bicyclic structure containing a quinazoline ring fused with a carbonyl group. This compound typically exhibits properties such as moderate solubility in polar solvents due to the presence of the hydroxyethyl group, which enhances its hydrophilicity. It may display biological activity, making it of interest in medicinal chemistry, particularly for its potential pharmacological effects. The presence of the methyl group and the hydroxyethyl substituent can influence its reactivity and interaction with biological targets. Additionally, the compound may participate in various chemical reactions, including nucleophilic substitutions and condensation reactions, due to the functional groups present. Its stability and reactivity can be affected by environmental conditions such as pH and temperature, which are important considerations in both laboratory and industrial applications.
Formula:C11H12N2O2
InChI:InChI=1S/C11H12N2O2/c1-8-12-10-5-3-2-4-9(10)11(15)13(8)6-7-14/h2-5,14H,6-7H2,1H3
InChI key:InChIKey=JRXGAWVXJUVHTD-UHFFFAOYSA-N
SMILES:O=C1C=2C(N=C(C)N1CCO)=CC=CC2
Synonyms:- 3-(2-Hydroxyethyl)-2-methyl-3,4-dihydro-4-quinazolinone
- 4(3H)-Quinazolinone, 3-(2-hydroxyethyl)-2-methyl-
- 3-(Hydroxyethyl)-2-methylquinazolin-4-one
- 3-(2-Hydroxyethyl)-2-methyl-4(3H)-quinazolinone
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.