CAS 103765-03-3
:(R)-(-)-2-AMINOBUTANAMIDE HYDROCHLORIDE
Description:
(R)-(-)-2-Aminobutanamide hydrochloride is a chiral amine compound characterized by its amine functional group and a butanamide structure. It is a white to off-white crystalline solid that is soluble in water, which is typical for many amine hydrochlorides due to the presence of the hydrochloride salt form. This compound is often used in pharmaceutical research and synthesis, particularly in the development of chiral drugs, as its stereochemistry can influence biological activity. The presence of the amino group allows for potential interactions with biological targets, making it relevant in medicinal chemistry. Additionally, the hydrochloride form enhances its stability and solubility, facilitating its use in various chemical reactions and formulations. Safety data sheets indicate that, like many amines, it should be handled with care, as it may cause irritation upon contact with skin or eyes. Overall, (R)-(-)-2-Aminobutanamide hydrochloride is significant in both synthetic organic chemistry and pharmaceutical applications due to its unique structural and chemical properties.
Formula:C4H11ClN2O
InChI:InChI=1/C4H10N2O.ClH/c1-2-3(5)4(6)7;/h3H,2,5H2,1H3,(H2,6,7);1H/t3-;/m1./s1
SMILES:CC[C@H](C(=N)O)N.Cl
Synonyms:- (R)-2-AminobutanamideHCl
- (R)-2-Aminobutyramide hydrochloride
- (2R)-2-aminobutanamide hydrochloride
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 6 products.
(R)-(-)-2-Aminobutanamide hydrochloride
CAS:Formula:C4H11ClN2OPurity:95%Color and Shape:SolidMolecular weight:138.5959(R)-2-aminobutanamide hydrochloride
CAS:(R)-2-aminobutanamide hydrochloridePurity:98%Molecular weight:138.60g/mol(R)-2-Aminobutyramide Hydrochloride
CAS:Controlled Product<p>Applications (R)-2-Aminobutyramide Hydrochloride is used as a reagent in the synthesis of a new class of 2-[(arylalkyl)amino]alkanamide derivatives which have anticonvulsant activity.<br>References Pevarello, P., et al.: J. Med. Chem., 41, 579 (1998)<br></p>Formula:C4H11ClN2OColor and Shape:NeatMolecular weight:138.6(R)-2-Aminobutanamide hydrochloride
CAS:Formula:C4H11ClN2OPurity:95%Color and Shape:SolidMolecular weight:138.6(R)-2-Aminobutanamide hydrochloride
CAS:<p>(R)-2-Aminobutanamide hydrochloride is a compound that contains chloride gas. This compound is an alkylating agent, which means it can form new carbon-nitrogen bonds by adding to the electrophilic center of a molecule. This process is used industrially to produce butyronitrile, which is a precursor for nylon and other plastics. The introduction of (R)-2-aminobutanamide hydrochloride into industrial processes has decreased the use of l-tartaric acid, diluent, and hydrogen chloride. The impurities in this compound are typically quantified using gas chromatography with flame ionization detection.<br>(R)-2-Aminobutanamide hydrochloride is an acidic compound that dissociates in water to release hydrogen chloride. It has two chiral forms: <br>The enantiomers have different chemical properties due to their different configurations around the central carbon atom. In the case of (</p>Formula:C4H10N2O·HClPurity:Min. 95%Color and Shape:White PowderMolecular weight:138.6 g/mol





