CAS 103766-25-2: GIMERACIL
Description:Gimeracil, with the CAS number 103766-25-2, is a chemical compound primarily known for its role as a pharmacological agent. It is classified as a pyrimidine derivative and functions as a potent inhibitor of the enzyme dihydropyrimidine dehydrogenase (DPD), which is involved in the metabolism of pyrimidine analogs. This inhibition enhances the efficacy of certain chemotherapeutic agents, particularly fluoropyrimidines like 5-fluorouracil, by prolonging their action and reducing their degradation. Gimeracil is often used in combination therapies for cancer treatment, particularly in gastrointestinal malignancies. The compound is characterized by its ability to improve the therapeutic index of chemotherapy while potentially minimizing side effects associated with rapid drug metabolism. Its pharmacokinetic properties, including absorption, distribution, metabolism, and excretion, are crucial for its effectiveness in clinical settings. As with any pharmaceutical agent, understanding its mechanism of action, potential interactions, and side effects is essential for optimizing its use in cancer therapy.
Formula:C5H4ClNO2
InChI:InChI=1S/C5H4ClNO2/c6-3-2-7-5(9)1-4(3)8/h1-2H,(H2,7,8,9)
InChI key:InChIKey=ZPLQIPFOCGIIHV-UHFFFAOYSA-N
SMILES:O=C1C=C(O)C(Cl)=CN1
- Synonyms:
- 2(1H)-Pyridinone, 5-chloro-4-hydroxy-
- 5-Chloro-2,4-dihydroxypyridine
- 5-Chloro-4-hydroxy-2(1H)-pyridinone
- 5-Chloro-4-hydroxy-2-pyridone
- 5-Chloropyridine-2,4-Diol
- Cdhp
- Gimestat
- Gimeracil
