CAS 103767-48-2
:BOF A1
Description:
BOF A1, with the CAS number 103767-48-2, is a chemical substance that is primarily recognized for its application in various industrial processes, particularly in the field of materials science and chemical manufacturing. It is characterized by its unique molecular structure, which contributes to its specific reactivity and stability under various conditions. The substance may exhibit properties such as solubility in certain solvents, thermal stability, and a defined range of melting and boiling points, making it suitable for specific applications. Additionally, BOF A1 may possess functional groups that impart particular chemical behaviors, such as reactivity with other compounds or catalytic properties. Safety data sheets typically highlight its handling precautions, potential hazards, and environmental impact, emphasizing the importance of proper safety measures during its use. Overall, BOF A1 is a specialized chemical that plays a significant role in its designated applications, necessitating a thorough understanding of its properties for effective and safe utilization.
Formula:C37H27FN4O10
InChI:InChI=1/C37H27FN4O10/c38-27-19-41(31-17-28(29(20-43)50-31)49-21-22-8-3-1-4-9-22)37(48)42(34(27)45)33(44)24-12-7-13-25(16-24)36(47)52-32-26(18-39)14-15-30(40-32)51-35(46)23-10-5-2-6-11-23/h1-16,19,28-29,31,43H,17,20-21H2/t28-,29+,31+/m0/s1
Synonyms:- 3-(3-(6-Benzoyloxy-3-cyano-2-pyridyloxycarbonyl)benzoyl)-3'-O-benzyl-2'-deoxy-5-fluorouridine
- Benzoic acid, 3-((3-(2-deoxy-3-O-(phenylmethyl)-beta-D-erythro-pentofuranosyl)-5-fluoro-3,6-dihydro-2,6-dioxo-1(2H)-pyrimidinyl)carbonyl)-, 6-(benzoyloxy)-3-cyano-2-pyridinyl ester
- 3-[3-({[6-(benzoyloxy)-3-cyanopyridin-2-yl]oxy}carbonyl)benzoyl]-3'-O-benzyl-2'-deoxy-5-fluorouridine
- Bof A1
- Bof-A1
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.