
CAS 10377-81-8
:Monoethanolamine borate
Description:
Monoethanolamine borate, with the CAS number 10377-81-8, is a chemical compound that combines monoethanolamine, an amine with a hydroxyl group, and boric acid or its derivatives. This substance typically appears as a white to off-white solid and is soluble in water, which enhances its utility in various applications. Monoethanolamine borate exhibits properties such as being a mild alkaline agent and can act as a buffering agent, making it useful in formulations that require pH stabilization. It is often utilized in the cosmetic and personal care industries, as well as in agricultural applications, particularly as a nutrient source for plants. Additionally, it may have applications in pharmaceuticals and as a corrosion inhibitor. Safety data indicates that, while it is generally considered to have low toxicity, appropriate handling and safety measures should be observed to minimize exposure. Overall, monoethanolamine borate is valued for its multifunctional properties in diverse fields.
Formula:C2H8BNO3
InChI:InChI=1S/C2H8BNO3/c4-1-2-7-3(5)6/h5-6H,1-2,4H2
InChI key:InChIKey=JCAYXDKNUSEQRT-UHFFFAOYSA-N
SMILES:O(B(O)O)CCN
Synonyms:- Actracor M
- Ethanol, 2-amino-, ester with boric acid (H3BO3) (1:1)
- Ethanolamine borate (1:1)
- Trigamine
- Monoethanolamine borate
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.

