CymitQuimica logo

CAS 10377-95-4

:

2-[Bis(2-hydroxyethyl)amino]ethyl salicylate

Description:
2-[Bis(2-hydroxyethyl)amino]ethyl salicylate, with the CAS number 10377-95-4, is a chemical compound that features a salicylate moiety linked to a bis(2-hydroxyethyl)amino group. This structure imparts both hydrophilic and hydrophobic characteristics, making it soluble in various solvents, particularly in polar environments. The presence of hydroxyl groups contributes to its potential as a chelating agent and enhances its reactivity with metal ions. The compound is often studied for its applications in pharmaceuticals and biochemistry, particularly in drug formulation and delivery systems due to its ability to interact with biological membranes. Additionally, its salicylate component may provide anti-inflammatory properties, which can be beneficial in therapeutic contexts. The compound's stability and compatibility with other substances are essential for its practical applications, and it is typically handled with standard safety precautions due to its chemical reactivity. Overall, 2-[Bis(2-hydroxyethyl)amino]ethyl salicylate is a versatile compound with significant potential in various scientific fields.
Formula:C13H19NO5
InChI:InChI=1S/C13H19NO5/c15-8-5-14(6-9-16)7-10-19-13(18)11-3-1-2-4-12(11)17/h1-4,15-17H,5-10H2
InChI key:InChIKey=NAFDCRMGWKHMJQ-UHFFFAOYSA-N
SMILES:C(OCCN(CCO)CCO)(=O)C1=C(O)C=CC=C1
Synonyms:
  • Ethanol, 2,2′,2′′-nitrilotri-, monosalicylate (ester)
  • 2-[Bis(2-hydroxyethyl)amino]ethyl salicylate
  • Benzoic acid, 2-hydroxy-, 2-[bis(2-hydroxyethyl)amino]ethyl ester
  • 2-[Bis(2-hydroxyethyl)amino]ethyl 2-hydroxybenzoate
  • Salicylic acid, 2-[bis(2-hydroxyethyl)amino]ethyl ester
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.