CAS 103772-14-1
:5-Amino-l-Cyclopropyl-6,7, 8-Trifluoro-1,4-Dihydro-4-Oxo-3-Quinolinearboxylic Acid
Description:
5-Amino-1-Cyclopropyl-6,7,8-Trifluoro-1,4-Dihydro-4-Oxo-3-Quinolinecarboxylic Acid, with CAS number 103772-14-1, is a synthetic organic compound characterized by its unique quinoline structure, which includes a cyclopropyl group and trifluoromethyl substituents. This compound features an amino group that enhances its potential for biological activity, making it of interest in medicinal chemistry. The presence of trifluoromethyl groups typically increases lipophilicity and can influence the compound's pharmacokinetic properties. The dihydro and oxo functionalities contribute to its reactivity and stability, while the carboxylic acid group may facilitate interactions with biological targets. Overall, this compound's structural characteristics suggest potential applications in drug development, particularly in targeting specific enzymes or receptors due to its ability to form hydrogen bonds and engage in hydrophobic interactions. However, detailed studies on its biological activity, toxicity, and pharmacological profile would be necessary to fully understand its potential uses.
Formula:C13H9F3N2O3
InChI:InChI=1/C13H9F3N2O3/c14-7-8(15)10(17)6-11(9(7)16)18(4-1-2-4)3-5(12(6)19)13(20)21/h3-4H,1-2,17H2,(H,20,21)
SMILES:C1CC1n1cc(c(=O)c2c(c(c(c(c12)F)F)F)N)C(=O)O
Synonyms:- 5-Amino-1-cyclopropyl-1,4-dihydro-4-oxo-6,7,8-trifluoro-3-quinolinecarboxyl
- 5-Amino-1-Cyclopropyl-6,7,8-Trifluoro-4-Oxo-1,4-Dihydroquinoline-3-Carboxylic Acid
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 2 products.

