CymitQuimica logo

CAS 103774-42-1

:

5-(1-Methylethyl)-3-phenyl-2,4-imidazolidinedione

Description:
5-(1-Methylethyl)-3-phenyl-2,4-imidazolidinedione, also known as a derivative of imidazolidinedione, is a chemical compound characterized by its unique bicyclic structure that includes an imidazolidine ring. This compound features a phenyl group and an isopropyl group, contributing to its distinct chemical properties. It is typically a white to off-white solid at room temperature and is soluble in organic solvents, which makes it useful in various chemical applications. The presence of the imidazolidinedione moiety suggests potential biological activity, often explored in pharmaceutical research. Its molecular structure allows for interactions with biological targets, making it of interest in medicinal chemistry. Additionally, the compound may exhibit specific reactivity patterns typical of imidazolidinediones, such as forming derivatives through nucleophilic substitution or condensation reactions. Overall, 5-(1-Methylethyl)-3-phenyl-2,4-imidazolidinedione is a compound of interest due to its structural features and potential applications in drug development and organic synthesis.
Formula:C12H14N2O2
InChI:InChI=1S/C12H14N2O2/c1-8(2)10-11(15)14(12(16)13-10)9-6-4-3-5-7-9/h3-8,10H,1-2H3,(H,13,16)
InChI key:InChIKey=IMGTWTDIKSLLMB-UHFFFAOYSA-N
SMILES:O=C1N(C(=O)NC1C(C)C)C2=CC=CC=C2
Synonyms:
  • 5-(1-Methylethyl)-3-phenyl-2,4-imidazolidinedione
  • 5-Isopropyl-3-phenylhydantoin
  • 2,4-Imidazolidinedione, 5-(1-methylethyl)-3-phenyl-, (±)-
  • 3-Phenyl-5-propan-2-ylimidazolidine-2,4-dione
  • 2,4-Imidazolidinedione, 5-(1-methylethyl)-3-phenyl-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.