CAS 103775-14-0: Moexiprilat
Description:Moexiprilat is an active metabolite of the angiotensin-converting enzyme (ACE) inhibitor moexipril, primarily used in the treatment of hypertension. It functions by inhibiting the conversion of angiotensin I to angiotensin II, leading to vasodilation and reduced blood pressure. Moexiprilat is characterized by its ability to effectively lower blood pressure while having a relatively long half-life, allowing for once-daily dosing in clinical settings. The substance is typically administered in its salt form, which enhances its solubility and bioavailability. Moexiprilat exhibits a favorable pharmacokinetic profile, with peak plasma concentrations occurring within a few hours after administration. Additionally, it is known for its minimal side effects, making it a preferred choice among ACE inhibitors. As with other medications in its class, monitoring for potential interactions with other drugs and assessing renal function is essential during treatment. Overall, moexiprilat represents a significant therapeutic option for managing hypertension and related cardiovascular conditions.
Formula:C25H30N2O7
InChI:InChI=1/C25H30N2O7/c1-15(26-19(24(29)30)10-9-16-7-5-4-6-8-16)23(28)27-14-18-13-22(34-3)21(33-2)12-17(18)11-20(27)25(31)32/h4-8,12-13,15,19-20,26H,9-11,14H2,1-3H3,(H,29,30)(H,31,32)/t15-,19-,20-/m0/s1
- Synonyms:
- Moexiprilat [INN]
- Rs 10029
- (3S)-2-((2S)-N-((1S)-1-Carboxy-3-phenylpropyl)alanyl)-1,2,3,4-tetrahydro-6,7-dimethoxy-3-isoquinolinecarboxylic acid
- Unii-H3753190Js
- (3S)-2-{N-[(1S)-1-carboxy-3-phenylpropyl]-L-alanyl}-6,7-dimethoxy-1,2,3,4-tetrahydroisoquinoline-3-carboxylic acid