
CAS 103775-96-8
:3-Chloro-L-alanine 1,1-dimethylethyl ester
Description:
3-Chloro-L-alanine 1,1-dimethylethyl ester is an organic compound characterized by its structure, which includes a chloro substituent on the alpha carbon of the L-alanine backbone, along with an ester functional group derived from 1,1-dimethylethanol. This compound is typically used in biochemical research and synthetic organic chemistry due to its potential as an amino acid derivative. It exhibits properties common to amino acids, such as the ability to participate in peptide bond formation, and its chloro group can serve as a reactive site for further chemical modifications. The presence of the ester group enhances its lipophilicity, which may influence its solubility and reactivity in biological systems. Additionally, the compound's chirality, stemming from the L-alanine configuration, is significant in biological contexts, as it may affect interactions with enzymes and receptors. Safety data should be consulted for handling, as halogenated compounds can pose health risks. Overall, 3-Chloro-L-alanine 1,1-dimethylethyl ester is a valuable compound in the field of medicinal chemistry and biochemistry.
Formula:C7H14ClNO2
InChI:InChI=1S/C7H14ClNO2/c1-7(2,3)11-6(10)5(9)4-8/h5H,4,9H2,1-3H3/t5-/m0/s1
InChI key:InChIKey=ZHTIJMDZNNCDOT-YFKPBYRVSA-N
SMILES:O(C([C@H](CCl)N)=O)C(C)(C)C
Synonyms:- L-Alanine, 3-chloro-, 1,1-dimethylethyl ester
- 3-Chloro-L-alanine 1,1-dimethylethyl ester
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.