CymitQuimica logo

CAS 10378-16-2

:

2-biphenyl-2-yl-1-(diaminomethylidene)guanidine

Description:
2-Biphenyl-2-yl-1-(diaminomethylidene)guanidine, identified by its CAS number 10378-16-2, is a chemical compound characterized by its guanidine structure, which features a biphenyl group. This compound typically exhibits properties associated with guanidines, such as basicity and potential for hydrogen bonding due to the presence of amino groups. It may also demonstrate biological activity, making it of interest in medicinal chemistry. The biphenyl moiety can influence its solubility and stability, potentially enhancing its lipophilicity. The presence of diaminomethylidene groups suggests that it may participate in various chemical reactions, including those involving nucleophilic attack or coordination with metal ions. Additionally, the compound's structure may allow for interactions with biological targets, which could be relevant in drug design or development. Overall, 2-biphenyl-2-yl-1-(diaminomethylidene)guanidine represents a unique class of compounds with potential applications in pharmaceuticals and materials science.
Formula:C14H15N5
InChI:InChI=1/C14H15N5/c15-13(16)19-14(17)18-12-9-5-4-8-11(12)10-6-2-1-3-7-10/h1-9H,(H6,15,16,17,18,19)
SMILES:c1ccc(cc1)c1ccccc1NC(=N)NC(=N)N
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.